About (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate
(4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate (PubChem CID 67721810) has the molecular formula C11H12ClN3O3
and a molecular weight of 269.69 g/mol. Its IUPAC name is (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate.
Molecular Properties
| Compound Name | (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate |
| PubChem CID | 67721810 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)CCC(N)=O)cc1Cl |
| InChI | InChI=1S/C11H12ClN3O3/c12-8-5-6(1-2-7(8)11(14)15)18-10(17)4-3-9(13)16/h1-2,5H,3-4H2,(H2,13,16)(H3,14,15) |
| InChIKey | VKHCYBPWRXOQAO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate?
The IUPAC name of (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate (CID 67721810) is (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate.
What is the SMILES notation for (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate?
The canonical SMILES for (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate is [H]/N=C(\N)c1ccc(OC(=O)CCC(N)=O)cc1Cl.
What is the InChIKey of (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate?
The InChIKey is VKHCYBPWRXOQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3O3/c12-8-5-6(1-2-7(8)11(14)15)18-10(17)4-3-9(13)16/h1-2,5H,3-4H2,(H2,13,16)(H3,14,15).
What are the key properties of (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate?
(4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate has a molecular weight of 269.69 g/mol, XLogP of 0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamimidoyl-3-chlorophenyl) 4-amino-4-oxobutanoate is sourced from PubChem (CID 67721810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).