C14H19NO9 — CID 67721857
[(1S)-1,8-diacetyloxy-6,7-dihydroxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate (PubChem CID 67721857) has the molecular formula C14H19NO9 and a molecular weight of 345.30 g/mol. Its IUPAC name is [(1S)-1,8-diacetyloxy-6,7-dihydroxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate.
| Compound Name | [(1S)-1,8-diacetyloxy-6,7-dihydroxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate |
|---|---|
| PubChem CID | 67721857 |
| Molecular Formula | C14H19NO9 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [(1S)-1,8-diacetyloxy-6,7-dihydroxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate |
| SMILES | CC(=O)OC1C(O)C(O)C(=O)N2CC(OC(C)=O)[C@@H](OC(C)=O)C12 |
| InChI | InChI=1S/C14H19NO9/c1-5(16)22-8-4-15-9(12(8)23-6(2)17)13(24-7(3)18)10(19)11(20)14(15)21/h8-13,19-20H,4H2,1-3H3/t8?,9?,10?,11?,12-,13?/m1/s1 |
| InChIKey | XSQXFMSZRDIZOM-RVTXZMPXSA-N |
| XLogP | -2.27 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|