C27H26F3N3O4 — CID 67722006
2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67722006) has the molecular formula C27H26F3N3O4 and a molecular weight of 513.52 g/mol. Its IUPAC name is 2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67722006 |
| Molecular Formula | C27H26F3N3O4 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCc1nc2ccc(N)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H25N3O2.C2HF3O2/c1-2-3-8-24-27-22-14-13-19(26)15-23(22)28(24)16-17-9-11-18(12-10-17)20-6-4-5-7-21(20)25(29)30;3-2(4,5)1(6)7/h4-7,9-15H,2-3,8,16,26H2,1H3,(H,29,30);(H,6,7) |
| InChIKey | BNOUFDBBMMHXGY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|