C39H42N4O2 — CID 67722243
3-[2-butyl-6-(1-hexyl-5-methylbenzimidazol-2-yl)benzimidazol-1-yl]-2-methyl-6-phenylbenzoic acid (PubChem CID 67722243) has the molecular formula C39H42N4O2 and a molecular weight of 598.79 g/mol. Its IUPAC name is 3-[2-butyl-6-(1-hexyl-5-methylbenzimidazol-2-yl)benzimidazol-1-yl]-2-methyl-6-phenylbenzoic acid.
| Compound Name | 3-[2-butyl-6-(1-hexyl-5-methylbenzimidazol-2-yl)benzimidazol-1-yl]-2-methyl-6-phenylbenzoic acid |
|---|---|
| PubChem CID | 67722243 |
| Molecular Formula | C39H42N4O2 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 3-[2-butyl-6-(1-hexyl-5-methylbenzimidazol-2-yl)benzimidazol-1-yl]-2-methyl-6-phenylbenzoic acid |
| SMILES | CCCCCCn1c(-c2ccc3nc(CCCC)n(-c4ccc(-c5ccccc5)c(C(=O)O)c4C)c3c2)nc2cc(C)ccc21 |
| InChI | InChI=1S/C39H42N4O2/c1-5-7-9-13-23-42-34-21-17-26(3)24-32(34)41-38(42)29-18-20-31-35(25-29)43(36(40-31)16-8-6-2)33-22-19-30(28-14-11-10-12-15-28)37(27(33)4)39(44)45/h10-12,14-15,17-22,24-25H,5-9,13,16,23H2,1-4H3,(H,44,45) |
| InChIKey | IKWPKPKGXBBXGE-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|