C9H15N4O5PS — CID 67722276
4-amino-1-[(2R,4S,5R)-5-[[amino(hydroxy)phosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 67722276) has the molecular formula C9H15N4O5PS and a molecular weight of 322.28 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-[[amino(hydroxy)phosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-[[amino(hydroxy)phosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 67722276 |
| Molecular Formula | C9H15N4O5PS |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-[[amino(hydroxy)phosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COP(N)(O)=S)O2)c(=O)n1 |
| InChI | InChI=1S/C9H15N4O5PS/c10-7-1-2-13(9(15)12-7)8-3-5(14)6(18-8)4-17-19(11,16)20/h1-2,5-6,8,14H,3-4H2,(H2,10,12,15)(H3,11,16,20)/t5-,6+,8+,19?/m0/s1 |
| InChIKey | OESWRITVCVWUPL-XRAHYEKOSA-N |
| XLogP | -1.33 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|