C28H32N4O3S — CID 67722295
1-[5-[2-[(1S)-1,2,3,4,4a,5,6,7-octahydroisoquinolin-1-yl]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-3-(3-methylphenyl)urea (PubChem CID 67722295) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is 1-[5-[2-[(1S)-1,2,3,4,4a,5,6,7-octahydroisoquinolin-1-yl]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[5-[2-[(1S)-1,2,3,4,4a,5,6,7-octahydroisoquinolin-1-yl]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 67722295 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 1-[5-[2-[(1S)-1,2,3,4,4a,5,6,7-octahydroisoquinolin-1-yl]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC2CSc3ccccc3N(CC(=O)[C@H]3NCCC4CCCC=C43)C2=O)c1 |
| InChI | InChI=1S/C28H32N4O3S/c1-18-7-6-9-20(15-18)30-28(35)31-22-17-36-25-12-5-4-11-23(25)32(27(22)34)16-24(33)26-21-10-3-2-8-19(21)13-14-29-26/h4-7,9-12,15,19,22,26,29H,2-3,8,13-14,16-17H2,1H3,(H2,30,31,35)/t19?,22?,26-/m0/s1 |
| InChIKey | YPPSURMGJFNBIW-ZWNWOPDOSA-N |
| XLogP | 4.28 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|