C18H23NO11 — CID 67722587
[(1S)-1,6,7,8-tetraacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate (PubChem CID 67722587) has the molecular formula C18H23NO11 and a molecular weight of 429.38 g/mol. Its IUPAC name is [(1S)-1,6,7,8-tetraacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate.
| Compound Name | [(1S)-1,6,7,8-tetraacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate |
|---|---|
| PubChem CID | 67722587 |
| Molecular Formula | C18H23NO11 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [(1S)-1,6,7,8-tetraacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate |
| SMILES | CC(=O)OC1C(=O)N2CC(OC(C)=O)[C@@H](OC(C)=O)C2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H23NO11/c1-7(20)26-12-6-19-13(14(12)27-8(2)21)15(28-9(3)22)16(29-10(4)23)17(18(19)25)30-11(5)24/h12-17H,6H2,1-5H3/t12?,13?,14-,15?,16?,17?/m1/s1 |
| InChIKey | LOSLILMBKQHCLZ-GSVLIZDISA-N |
| XLogP | -1.13 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|