C11H13N — CID 67722793
1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole (PubChem CID 67722793) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole.
| Compound Name | 1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole |
|---|---|
| PubChem CID | 67722793 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1,2,3,8,8a,8b-hexahydroindeno[2,1-b]pyrrole |
| SMILES | C1=CCC2C(=C1)C=C1NCCC12 |
| InChI | InChI=1S/C11H13N/c1-2-4-9-8(3-1)7-11-10(9)5-6-12-11/h1-3,7,9-10,12H,4-6H2 |
| InChIKey | VMPKSUIDTLGILV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |