C26H30O3Si — CID 67723037
4-[2-(8,8-dimethyl-5-oxo-6,7-dihydronaphthalen-2-yl)ethynyl]-2-(2-trimethylsilylethyl)benzoic acid (PubChem CID 67723037) has the molecular formula C26H30O3Si and a molecular weight of 418.61 g/mol. Its IUPAC name is 4-[2-(8,8-dimethyl-5-oxo-6,7-dihydronaphthalen-2-yl)ethynyl]-2-(2-trimethylsilylethyl)benzoic acid.
| Compound Name | 4-[2-(8,8-dimethyl-5-oxo-6,7-dihydronaphthalen-2-yl)ethynyl]-2-(2-trimethylsilylethyl)benzoic acid |
|---|---|
| PubChem CID | 67723037 |
| Molecular Formula | C26H30O3Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-[2-(8,8-dimethyl-5-oxo-6,7-dihydronaphthalen-2-yl)ethynyl]-2-(2-trimethylsilylethyl)benzoic acid |
| SMILES | CC1(C)CCC(=O)c2ccc(C#Cc3ccc(C(=O)O)c(CC[Si](C)(C)C)c3)cc21 |
| InChI | InChI=1S/C26H30O3Si/c1-26(2)14-12-24(27)22-11-9-19(17-23(22)26)7-6-18-8-10-21(25(28)29)20(16-18)13-15-30(3,4)5/h8-11,16-17H,12-15H2,1-5H3,(H,28,29) |
| InChIKey | JFRGMOUZCMEYTI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|