About piperidin-4-yl morpholine-4-carboxylate
piperidin-4-yl morpholine-4-carboxylate (PubChem CID 67723380) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is piperidin-4-yl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | piperidin-4-yl morpholine-4-carboxylate |
| PubChem CID | 67723380 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | piperidin-4-yl morpholine-4-carboxylate |
| SMILES | O=C(OC1CCNCC1)N1CCOCC1 |
| InChI | InChI=1S/C10H18N2O3/c13-10(12-5-7-14-8-6-12)15-9-1-3-11-4-2-9/h9,11H,1-8H2 |
| InChIKey | ULFBIAWHNKDNHR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-4-yl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl morpholine-4-carboxylate?
The IUPAC name of piperidin-4-yl morpholine-4-carboxylate (CID 67723380) is piperidin-4-yl morpholine-4-carboxylate.
What is the SMILES notation for piperidin-4-yl morpholine-4-carboxylate?
The canonical SMILES for piperidin-4-yl morpholine-4-carboxylate is O=C(OC1CCNCC1)N1CCOCC1.
What is the InChIKey of piperidin-4-yl morpholine-4-carboxylate?
The InChIKey is ULFBIAWHNKDNHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c13-10(12-5-7-14-8-6-12)15-9-1-3-11-4-2-9/h9,11H,1-8H2.
What are the key properties of piperidin-4-yl morpholine-4-carboxylate?
piperidin-4-yl morpholine-4-carboxylate has a molecular weight of 214.26 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl morpholine-4-carboxylate is sourced from PubChem (CID 67723380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).