C22H36IN — CID 67723541
(1R)-3-[2-(1-iodo-2-adamantyl)ethyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane (PubChem CID 67723541) has the molecular formula C22H36IN and a molecular weight of 441.44 g/mol. Its IUPAC name is (1R)-3-[2-(1-iodo-2-adamantyl)ethyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane.
| Compound Name | (1R)-3-[2-(1-iodo-2-adamantyl)ethyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 67723541 |
| Molecular Formula | C22H36IN |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (1R)-3-[2-(1-iodo-2-adamantyl)ethyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)C2CC[C@@]1(C)CN(CCC1C3CC4CC(C3)CC1(I)C4)C2 |
| InChI | InChI=1S/C22H36IN/c1-20(2)18-4-6-21(20,3)14-24(13-18)7-5-19-17-9-15-8-16(10-17)12-22(19,23)11-15/h15-19H,4-14H2,1-3H3/t15?,16?,17?,18?,19?,21-,22?/m0/s1 |
| InChIKey | NHSVFCZFCONJMQ-SVFWYXTNSA-N |
| XLogP | 5.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|