About 3-methylpentan-2-one;oxolane
3-methylpentan-2-one;oxolane (PubChem CID 67724312) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-methylpentan-2-one;oxolane.
Molecular Properties
| Compound Name | 3-methylpentan-2-one;oxolane |
| PubChem CID | 67724312 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 3-methylpentan-2-one;oxolane |
| SMILES | C1CCOC1.CCC(C)C(C)=O |
| InChI | InChI=1S/C6H12O.C4H8O/c1-4-5(2)6(3)7;1-2-4-5-3-1/h5H,4H2,1-3H3;1-4H2 |
| InChIKey | XLQRYQSEJSKJLP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylpentan-2-one;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentan-2-one;oxolane?
The IUPAC name of 3-methylpentan-2-one;oxolane (CID 67724312) is 3-methylpentan-2-one;oxolane.
What is the SMILES notation for 3-methylpentan-2-one;oxolane?
The canonical SMILES for 3-methylpentan-2-one;oxolane is C1CCOC1.CCC(C)C(C)=O.
What is the InChIKey of 3-methylpentan-2-one;oxolane?
The InChIKey is XLQRYQSEJSKJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C4H8O/c1-4-5(2)6(3)7;1-2-4-5-3-1/h5H,4H2,1-3H3;1-4H2.
What are the key properties of 3-methylpentan-2-one;oxolane?
3-methylpentan-2-one;oxolane has a molecular weight of 172.27 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentan-2-one;oxolane is sourced from PubChem (CID 67724312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).