C26H30N4O5S — CID 67724496
N-[[1-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-5-(1,3-oxazol-2-yl)-2-phenylcyclohexa-2,4-dien-1-yl]methyl]-2,2-dimethylpropanamide (PubChem CID 67724496) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[[1-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-5-(1,3-oxazol-2-yl)-2-phenylcyclohexa-2,4-dien-1-yl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[1-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-5-(1,3-oxazol-2-yl)-2-phenylcyclohexa-2,4-dien-1-yl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 67724496 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-[[1-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-5-(1,3-oxazol-2-yl)-2-phenylcyclohexa-2,4-dien-1-yl]methyl]-2,2-dimethylpropanamide |
| SMILES | Cc1noc(NS(=O)(=O)C2(CNC(=O)C(C)(C)C)CC(c3ncco3)=CC=C2c2ccccc2)c1C |
| InChI | InChI=1S/C26H30N4O5S/c1-17-18(2)29-35-22(17)30-36(32,33)26(16-28-24(31)25(3,4)5)15-20(23-27-13-14-34-23)11-12-21(26)19-9-7-6-8-10-19/h6-14,30H,15-16H2,1-5H3,(H,28,31) |
| InChIKey | QUAYNEWRFOHHJM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |