C18H28O — CID 67724725
(8R,9S,10R,13R,14S)-13-methyl-2,3,4,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol (PubChem CID 67724725) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S)-13-methyl-2,3,4,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol.
| Compound Name | (8R,9S,10R,13R,14S)-13-methyl-2,3,4,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 67724725 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (8R,9S,10R,13R,14S)-13-methyl-2,3,4,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-5-ol |
| SMILES | C[C@@]12C=CC[C@H]1[C@@H]1CCC3(O)CCCC[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C18H28O/c1-17-9-4-6-15(17)13-8-12-18(19)10-3-2-5-16(18)14(13)7-11-17/h4,9,13-16,19H,2-3,5-8,10-12H2,1H3/t13-,14+,15+,16-,17+,18?/m1/s1 |
| InChIKey | GXTIZIBWCUUZSN-PPRNGETMSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|