About 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone
1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone (PubChem CID 67724996) has the molecular formula C7H12FNO
and a molecular weight of 145.18 g/mol. Its IUPAC name is 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone |
| PubChem CID | 67724996 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@@H](F)CN1C |
| InChI | InChI=1S/C7H12FNO/c1-5(10)7-3-6(8)4-9(7)2/h6-7H,3-4H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | UUEPTSRPKLYKNS-RQJHMYQMSA-N |
| XLogP | 0.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone?
The IUPAC name of 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone (CID 67724996) is 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone.
What is the SMILES notation for 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone?
The canonical SMILES for 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone is CC(=O)[C@@H]1C[C@@H](F)CN1C.
What is the InChIKey of 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone?
The InChIKey is UUEPTSRPKLYKNS-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H12FNO/c1-5(10)7-3-6(8)4-9(7)2/h6-7H,3-4H2,1-2H3/t6-,7+/m1/s1.
What are the key properties of 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone?
1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone has a molecular weight of 145.18 g/mol, XLogP of 0.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]ethanone is sourced from PubChem (CID 67724996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).