C16H24O2 — CID 67725409
9-(2-methylheptan-2-yl)-2-oxabicyclo[3.3.1]nona-1(9),5,7-trien-6-ol (PubChem CID 67725409) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 9-(2-methylheptan-2-yl)-2-oxabicyclo[3.3.1]nona-1(9),5,7-trien-6-ol.
| Compound Name | 9-(2-methylheptan-2-yl)-2-oxabicyclo[3.3.1]nona-1(9),5,7-trien-6-ol |
|---|---|
| PubChem CID | 67725409 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 9-(2-methylheptan-2-yl)-2-oxabicyclo[3.3.1]nona-1(9),5,7-trien-6-ol |
| SMILES | CCCCCC(C)(C)c1c2ccc(O)c1CCO2 |
| InChI | InChI=1S/C16H24O2/c1-4-5-6-10-16(2,3)15-12-9-11-18-14(15)8-7-13(12)17/h7-8,17H,4-6,9-11H2,1-3H3 |
| InChIKey | LKGDWXYUPSPTPF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|