About oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate
oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate (PubChem CID 67725514) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate.
Molecular Properties
| Compound Name | oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate |
| PubChem CID | 67725514 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate |
| SMILES | CC[C@@H](NC(=O)OC1CCOCC1)C(C)C |
| InChI | InChI=1S/C12H23NO3/c1-4-11(9(2)3)13-12(14)16-10-5-7-15-8-6-10/h9-11H,4-8H2,1-3H3,(H,13,14)/t11-/m1/s1 |
| InChIKey | SGCLZXYXAZRUHT-LLVKDONJSA-N |
| XLogP | 2.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate?
The IUPAC name of oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate (CID 67725514) is oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate.
What is the SMILES notation for oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate?
The canonical SMILES for oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate is CC[C@@H](NC(=O)OC1CCOCC1)C(C)C.
What is the InChIKey of oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate?
The InChIKey is SGCLZXYXAZRUHT-LLVKDONJSA-N. The full InChI is InChI=1S/C12H23NO3/c1-4-11(9(2)3)13-12(14)16-10-5-7-15-8-6-10/h9-11H,4-8H2,1-3H3,(H,13,14)/t11-/m1/s1.
What are the key properties of oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate?
oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate has a molecular weight of 229.32 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl N-[(3R)-2-methylpentan-3-yl]carbamate is sourced from PubChem (CID 67725514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).