About 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine
4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine (PubChem CID 67726053) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 67726053 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine |
| SMILES | CCCCCN1CC=C(OC)CC1 |
| InChI | InChI=1S/C11H21NO/c1-3-4-5-8-12-9-6-11(13-2)7-10-12/h6H,3-5,7-10H2,1-2H3 |
| InChIKey | GJHQJGFSQMMDNA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine (CID 67726053) is 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine is CCCCCN1CC=C(OC)CC1.
What is the InChIKey of 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine?
The InChIKey is GJHQJGFSQMMDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-3-4-5-8-12-9-6-11(13-2)7-10-12/h6H,3-5,7-10H2,1-2H3.
What are the key properties of 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine?
4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine has a molecular weight of 183.29 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-pentyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 67726053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).