C32H34F3NO5S — CID 67726220
methyl (Z)-6-[(1R,2S,5S)-2-[(4-phenylphenyl)methoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclopentyl]hex-4-enoate (PubChem CID 67726220) has the molecular formula C32H34F3NO5S and a molecular weight of 601.69 g/mol. Its IUPAC name is methyl (Z)-6-[(1R,2S,5S)-2-[(4-phenylphenyl)methoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1R,2S,5S)-2-[(4-phenylphenyl)methoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 67726220 |
| Molecular Formula | C32H34F3NO5S |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | methyl (Z)-6-[(1R,2S,5S)-2-[(4-phenylphenyl)methoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclopentyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1[C@@H](NS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC[C@@H]1OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34F3NO5S/c1-40-31(37)11-7-3-6-10-28-29(36-42(38,39)27-18-16-26(17-19-27)32(33,34)35)20-21-30(28)41-22-23-12-14-25(15-13-23)24-8-4-2-5-9-24/h2-6,8-9,12-19,28-30,36H,7,10-11,20-22H2,1H3/b6-3-/t28-,29+,30+/m1/s1 |
| InChIKey | IUXZMNNMDVSVPL-DPUZXKDOSA-N |
| XLogP | 6.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|