C12H21N7 — CID 677265
1-(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)-1-methylhydrazine (PubChem CID 677265) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is 1-(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)-1-methylhydrazine.
| Compound Name | 1-(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)-1-methylhydrazine |
|---|---|
| PubChem CID | 677265 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)-1-methylhydrazine |
| SMILES | CN(N)c1nc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C12H21N7/c1-17(13)10-14-11(18-6-2-3-7-18)16-12(15-10)19-8-4-5-9-19/h2-9,13H2,1H3 |
| InChIKey | NAQUCIWMEKCLAU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|