C17H16Cl3NO3S — CID 67726588
methyl 2-[(2-benzylsulfanylacetyl)amino]-4,4,6-trichlorocyclohexa-1,5-diene-1-carboxylate (PubChem CID 67726588) has the molecular formula C17H16Cl3NO3S and a molecular weight of 420.75 g/mol. Its IUPAC name is methyl 2-[(2-benzylsulfanylacetyl)amino]-4,4,6-trichlorocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 2-[(2-benzylsulfanylacetyl)amino]-4,4,6-trichlorocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 67726588 |
| Molecular Formula | C17H16Cl3NO3S |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | methyl 2-[(2-benzylsulfanylacetyl)amino]-4,4,6-trichlorocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(NC(=O)CSCc2ccccc2)CC(Cl)(Cl)C=C1Cl |
| InChI | InChI=1S/C17H16Cl3NO3S/c1-24-16(23)15-12(18)7-17(19,20)8-13(15)21-14(22)10-25-9-11-5-3-2-4-6-11/h2-7H,8-10H2,1H3,(H,21,22) |
| InChIKey | CUZSFZUBCUXSBQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|