C22H18F2O6 — CID 67726826
2-[4-[2-(2,3-difluoro-4-propylphenyl)ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 67726826) has the molecular formula C22H18F2O6 and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-[4-[2-(2,3-difluoro-4-propylphenyl)ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | 2-[4-[2-(2,3-difluoro-4-propylphenyl)ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67726826 |
| Molecular Formula | C22H18F2O6 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[4-[2-(2,3-difluoro-4-propylphenyl)ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | CCCc1ccc(C#Cc2ccc(C3OC(C(=O)O)C(C(=O)O)O3)cc2)c(F)c1F |
| InChI | InChI=1S/C22H18F2O6/c1-2-3-13-10-11-14(17(24)16(13)23)7-4-12-5-8-15(9-6-12)22-29-18(20(25)26)19(30-22)21(27)28/h5-6,8-11,18-19,22H,2-3H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | KIHROMLCMRKNBV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|