C39H34N2NaO4 — CID 67726997
CID 67726997 (PubChem CID 67726997) has the molecular formula C39H34N2NaO4 and a molecular weight of 617.70 g/mol.
| Compound Name | CID 67726997 |
|---|---|
| PubChem CID | 67726997 |
| Molecular Formula | C39H34N2NaO4 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | — |
| SMILES | O=C(O)C1CCC(c2ccc(OCc3ccc4ccccc4n3)cc2)(c2ccc(OCc3ccc4ccccc4n3)cc2)CC1.[Na] |
| InChI | InChI=1S/C39H34N2O4.Na/c42-38(43)29-21-23-39(24-22-29,30-11-17-34(18-12-30)44-25-32-15-9-27-5-1-3-7-36(27)40-32)31-13-19-35(20-14-31)45-26-33-16-10-28-6-2-4-8-37(28)41-33;/h1-20,29H,21-26H2,(H,42,43); |
| InChIKey | CJTYGNQNDVVQRD-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |