C25H30F2O7Si — CID 67727193
[(2R,3R)-3-benzoyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-2-hydroxy-5-oxopentyl] benzoate (PubChem CID 67727193) has the molecular formula C25H30F2O7Si and a molecular weight of 508.59 g/mol. Its IUPAC name is [(2R,3R)-3-benzoyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-2-hydroxy-5-oxopentyl] benzoate.
| Compound Name | [(2R,3R)-3-benzoyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-2-hydroxy-5-oxopentyl] benzoate |
|---|---|
| PubChem CID | 67727193 |
| Molecular Formula | C25H30F2O7Si |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [(2R,3R)-3-benzoyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-2-hydroxy-5-oxopentyl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C(F)(F)[C@H](OC(=O)c1ccccc1)[C@H](O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30F2O7Si/c1-24(2,3)35(4,5)34-23(31)25(26,27)20(33-22(30)18-14-10-7-11-15-18)19(28)16-32-21(29)17-12-8-6-9-13-17/h6-15,19-20,28H,16H2,1-5H3/t19-,20-/m1/s1 |
| InChIKey | JJFJJGYKKSTKLE-WOJBJXKFSA-N |
| XLogP | 4.61 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|