About 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene
3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene (PubChem CID 67727301) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene.
Analyze 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene?
The IUPAC name of 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene (CID 67727301) is 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene.
What is the SMILES notation for 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene?
The canonical SMILES for 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene is C1=CC2=CC=NCC3CNC(=C1)C23.
What is the InChIKey of 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene?
The InChIKey is HJZYOXGIUGAJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-2-8-4-5-12-6-9-7-13-10(3-1)11(8)9/h1-5,9,11,13H,6-7H2.
What are the key properties of 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene?
3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene has a molecular weight of 172.23 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,11-diazatricyclo[6.4.1.04,13]trideca-4,6,8,10-tetraene is sourced from PubChem (CID 67727301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).