About 2-(1-benzylcyclohexyl)-1,4-dioxane
2-(1-benzylcyclohexyl)-1,4-dioxane (PubChem CID 67727429) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(1-benzylcyclohexyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-(1-benzylcyclohexyl)-1,4-dioxane |
| PubChem CID | 67727429 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-(1-benzylcyclohexyl)-1,4-dioxane |
| SMILES | c1ccc(CC2(C3COCCO3)CCCCC2)cc1 |
| InChI | InChI=1S/C17H24O2/c1-3-7-15(8-4-1)13-17(9-5-2-6-10-17)16-14-18-11-12-19-16/h1,3-4,7-8,16H,2,5-6,9-14H2 |
| InChIKey | JQBXHOLULSHZEI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-benzylcyclohexyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzylcyclohexyl)-1,4-dioxane?
The IUPAC name of 2-(1-benzylcyclohexyl)-1,4-dioxane (CID 67727429) is 2-(1-benzylcyclohexyl)-1,4-dioxane.
What is the SMILES notation for 2-(1-benzylcyclohexyl)-1,4-dioxane?
The canonical SMILES for 2-(1-benzylcyclohexyl)-1,4-dioxane is c1ccc(CC2(C3COCCO3)CCCCC2)cc1.
What is the InChIKey of 2-(1-benzylcyclohexyl)-1,4-dioxane?
The InChIKey is JQBXHOLULSHZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2/c1-3-7-15(8-4-1)13-17(9-5-2-6-10-17)16-14-18-11-12-19-16/h1,3-4,7-8,16H,2,5-6,9-14H2.
What are the key properties of 2-(1-benzylcyclohexyl)-1,4-dioxane?
2-(1-benzylcyclohexyl)-1,4-dioxane has a molecular weight of 260.38 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzylcyclohexyl)-1,4-dioxane is sourced from PubChem (CID 67727429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).