C36H50N2O5 — CID 67727959
[(4aR,6R,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67727959) has the molecular formula C36H50N2O5 and a molecular weight of 590.81 g/mol. Its IUPAC name is [(4aR,6R,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [(4aR,6R,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67727959 |
| Molecular Formula | C36H50N2O5 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | [(4aR,6R,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(C)C[C@H]2C(OC(C)=O)C[C@H](N(CC(C)C)C(=O)CCCCCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C36H50N2O5/c1-26(2)24-38(35(41)18-11-7-10-15-29-13-8-6-9-14-29)31-22-34(43-28(4)40)33-25-37(5)20-19-36(33,23-31)30-16-12-17-32(21-30)42-27(3)39/h6,8-9,12-14,16-17,21,26,31,33-34H,7,10-11,15,18-20,22-25H2,1-5H3/t31-,33-,34?,36-/m0/s1 |
| InChIKey | XBCBDCXJRUQJPN-OAPLMYFMSA-N |
| XLogP | 6.18 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|