C38H54N2O4 — CID 67728565
[3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-methoxy-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 67728565) has the molecular formula C38H54N2O4 and a molecular weight of 602.86 g/mol. Its IUPAC name is [3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-methoxy-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-methoxy-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67728565 |
| Molecular Formula | C38H54N2O4 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.41 |
| IUPAC Name | [3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-8-methoxy-6-[2-methylpropyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | COC1C[C@H](N(CC(C)C)C(=O)CCCCCc2ccccc2)C[C@]2(c3cccc(OC(C)=O)c3)CCN(CC3CC3)C[C@@H]12 |
| InChI | InChI=1S/C38H54N2O4/c1-28(2)25-40(37(42)17-10-6-9-14-30-12-7-5-8-13-30)33-23-36(43-4)35-27-39(26-31-18-19-31)21-20-38(35,24-33)32-15-11-16-34(22-32)44-29(3)41/h5,7-8,11-13,15-16,22,28,31,33,35-36H,6,9-10,14,17-21,23-27H2,1-4H3/t33-,35-,36?,38-/m0/s1 |
| InChIKey | VKIORKSQYQPKBO-BLJLQDDISA-N |
| XLogP | 7.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|