C31H36Cl2N2O5 — CID 67728692
[(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67728692) has the molecular formula C31H36Cl2N2O5 and a molecular weight of 587.54 g/mol. Its IUPAC name is [(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67728692 |
| Molecular Formula | C31H36Cl2N2O5 |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | [(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-6-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC(C)=O)c3)C[C@H](N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC(OC(C)=O)[C@@H]2C1 |
| InChI | InChI=1S/C31H36Cl2N2O5/c1-5-12-35-13-11-31(23-7-6-8-25(16-23)39-20(2)36)18-24(17-29(26(31)19-35)40-21(3)37)34(4)30(38)15-22-9-10-27(32)28(33)14-22/h5-10,14,16,24,26,29H,1,11-13,15,17-19H2,2-4H3/t24-,26+,29?,31+/m1/s1 |
| InChIKey | ATVLQMMPVDLPFZ-JWOGJMGISA-N |
| XLogP | 5.46 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|