About 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine
2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine (PubChem CID 67728757) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine |
| PubChem CID | 67728757 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine |
| SMILES | C=CCN1CCN=C1CCN |
| InChI | InChI=1S/C8H15N3/c1-2-6-11-7-5-10-8(11)3-4-9/h2H,1,3-7,9H2 |
| InChIKey | CJKVGTVCRVEIQC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine?
The IUPAC name of 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine (CID 67728757) is 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine.
What is the SMILES notation for 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine?
The canonical SMILES for 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine is C=CCN1CCN=C1CCN.
What is the InChIKey of 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine?
The InChIKey is CJKVGTVCRVEIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-2-6-11-7-5-10-8(11)3-4-9/h2H,1,3-7,9H2.
What are the key properties of 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine?
2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine has a molecular weight of 153.23 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-prop-2-enyl-4,5-dihydroimidazol-2-yl)ethanamine is sourced from PubChem (CID 67728757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).