C23H28N2O3 — CID 67728923
N-[(6R)-8-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide (PubChem CID 67728923) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[(6R)-8-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide.
| Compound Name | N-[(6R)-8-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 67728923 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[(6R)-8-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]benzamide |
| SMILES | CN1CCC2(c3cccc(O)c3)C[C@@H](NC(=O)c3ccccc3)CC(O)C2C1 |
| InChI | InChI=1S/C23H28N2O3/c1-25-11-10-23(17-8-5-9-19(26)12-17)14-18(13-21(27)20(23)15-25)24-22(28)16-6-3-2-4-7-16/h2-9,12,18,20-21,26-27H,10-11,13-15H2,1H3,(H,24,28)/t18-,20?,21?,23?/m0/s1 |
| InChIKey | HFYMWOGEEXMHEG-LXVNSMRVSA-N |
| XLogP | 2.54 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |