C29H33N3O2 — CID 67729046
N-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide (PubChem CID 67729046) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide.
| Compound Name | N-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 67729046 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2cccc(O)c2)N(C(=O)c2ccccc2)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C29H33N3O2/c1-4-18-30-20-23(3)31(21-22(30)2)28(25-14-11-17-27(33)19-25)32(26-15-9-6-10-16-26)29(34)24-12-7-5-8-13-24/h4-17,19,22-23,28,33H,1,18,20-21H2,2-3H3/t22-,23+,28-/m1/s1 |
| InChIKey | NJKSIKJMBWQFBD-AWVRMFGXSA-N |
| XLogP | 5.32 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|