C30H35FN3O5P — CID 67729090
[3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-[3-[(3-fluorophenyl)-methylcarbamoyl]phenyl]methyl]phenyl] dihydrogen phosphate (PubChem CID 67729090) has the molecular formula C30H35FN3O5P and a molecular weight of 567.60 g/mol. Its IUPAC name is [3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-[3-[(3-fluorophenyl)-methylcarbamoyl]phenyl]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-[3-[(3-fluorophenyl)-methylcarbamoyl]phenyl]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67729090 |
| Molecular Formula | C30H35FN3O5P |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | [3-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-[3-[(3-fluorophenyl)-methylcarbamoyl]phenyl]methyl]phenyl] dihydrogen phosphate |
| SMILES | C=CCN1C[C@H](C)N(C(c2cccc(OP(=O)(O)O)c2)c2cccc(C(=O)N(C)c3cccc(F)c3)c2)C[C@H]1C |
| InChI | InChI=1S/C30H35FN3O5P/c1-5-15-33-19-22(3)34(20-21(33)2)29(24-10-7-14-28(17-24)39-40(36,37)38)23-9-6-11-25(16-23)30(35)32(4)27-13-8-12-26(31)18-27/h5-14,16-18,21-22,29H,1,15,19-20H2,2-4H3,(H2,36,37,38)/t21-,22+,29?/m1/s1 |
| InChIKey | MYHMLRMWFBDHNX-QQRJRCLASA-N |
| XLogP | 5.24 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|