About 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid
2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid (PubChem CID 67729131) has the molecular formula C11H16O4
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid.
Molecular Properties
| Compound Name | 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid |
| PubChem CID | 67729131 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)C1=CCC(O)(O)C=C1 |
| InChI | InChI=1S/C11H16O4/c1-2-3-9(10(12)13)8-4-6-11(14,15)7-5-8/h4-6,9,14-15H,2-3,7H2,1H3,(H,12,13) |
| InChIKey | FMVCGOBTBFEAMN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid?
The IUPAC name of 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid (CID 67729131) is 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid.
What is the SMILES notation for 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid?
The canonical SMILES for 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid is CCCC(C(=O)O)C1=CCC(O)(O)C=C1.
What is the InChIKey of 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid?
The InChIKey is FMVCGOBTBFEAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-2-3-9(10(12)13)8-4-6-11(14,15)7-5-8/h4-6,9,14-15H,2-3,7H2,1H3,(H,12,13).
What are the key properties of 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid?
2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid has a molecular weight of 212.25 g/mol, XLogP of 1.05, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)pentanoic acid is sourced from PubChem (CID 67729131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).