About 5,7-dihydro-1-benzazepin-6-one;dihydrobromide
5,7-dihydro-1-benzazepin-6-one;dihydrobromide (PubChem CID 67729416) has the molecular formula C10H11Br2NO
and a molecular weight of 321.01 g/mol. Its IUPAC name is 5,7-dihydro-1-benzazepin-6-one;dihydrobromide.
Molecular Properties
| Compound Name | 5,7-dihydro-1-benzazepin-6-one;dihydrobromide |
| PubChem CID | 67729416 |
| Molecular Formula | C10H11Br2NO |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 5,7-dihydro-1-benzazepin-6-one;dihydrobromide |
| SMILES | Br.Br.O=C1CC=CC2=C1CC=CC=N2 |
| InChI | InChI=1S/C10H9NO.2BrH/c12-10-6-3-5-9-8(10)4-1-2-7-11-9;;/h1-3,5,7H,4,6H2;2*1H |
| InChIKey | AXPXAKCJNBBNKO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dihydro-1-benzazepin-6-one;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydro-1-benzazepin-6-one;dihydrobromide?
The IUPAC name of 5,7-dihydro-1-benzazepin-6-one;dihydrobromide (CID 67729416) is 5,7-dihydro-1-benzazepin-6-one;dihydrobromide.
What is the SMILES notation for 5,7-dihydro-1-benzazepin-6-one;dihydrobromide?
The canonical SMILES for 5,7-dihydro-1-benzazepin-6-one;dihydrobromide is Br.Br.O=C1CC=CC2=C1CC=CC=N2.
What is the InChIKey of 5,7-dihydro-1-benzazepin-6-one;dihydrobromide?
The InChIKey is AXPXAKCJNBBNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.2BrH/c12-10-6-3-5-9-8(10)4-1-2-7-11-9;;/h1-3,5,7H,4,6H2;2*1H.
What are the key properties of 5,7-dihydro-1-benzazepin-6-one;dihydrobromide?
5,7-dihydro-1-benzazepin-6-one;dihydrobromide has a molecular weight of 321.01 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydro-1-benzazepin-6-one;dihydrobromide is sourced from PubChem (CID 67729416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).