About 2,9a-dihydropyrimido[2,1-b][1,3]thiazine
2,9a-dihydropyrimido[2,1-b][1,3]thiazine (PubChem CID 67729636) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is 2,9a-dihydropyrimido[2,1-b][1,3]thiazine.
Molecular Properties
| Compound Name | 2,9a-dihydropyrimido[2,1-b][1,3]thiazine |
| PubChem CID | 67729636 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 2,9a-dihydropyrimido[2,1-b][1,3]thiazine |
| SMILES | C1=CN2C=CCSC2N=C1 |
| InChI | InChI=1S/C7H8N2S/c1-3-8-7-9(4-1)5-2-6-10-7/h1-5,7H,6H2 |
| InChIKey | XFLIHLOQFDBNRW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,9a-dihydropyrimido[2,1-b][1,3]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9a-dihydropyrimido[2,1-b][1,3]thiazine?
The IUPAC name of 2,9a-dihydropyrimido[2,1-b][1,3]thiazine (CID 67729636) is 2,9a-dihydropyrimido[2,1-b][1,3]thiazine.
What is the SMILES notation for 2,9a-dihydropyrimido[2,1-b][1,3]thiazine?
The canonical SMILES for 2,9a-dihydropyrimido[2,1-b][1,3]thiazine is C1=CN2C=CCSC2N=C1.
What is the InChIKey of 2,9a-dihydropyrimido[2,1-b][1,3]thiazine?
The InChIKey is XFLIHLOQFDBNRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S/c1-3-8-7-9(4-1)5-2-6-10-7/h1-5,7H,6H2.
What are the key properties of 2,9a-dihydropyrimido[2,1-b][1,3]thiazine?
2,9a-dihydropyrimido[2,1-b][1,3]thiazine has a molecular weight of 152.22 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9a-dihydropyrimido[2,1-b][1,3]thiazine is sourced from PubChem (CID 67729636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).