About 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole
2-methyl-4,5-dihydro-1H-imidazole;1-methylindole (PubChem CID 67729957) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole.
Molecular Properties
| Compound Name | 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole |
| PubChem CID | 67729957 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole |
| SMILES | CC1=NCCN1.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.C4H8N2/c1-10-7-6-8-4-2-3-5-9(8)10;1-4-5-2-3-6-4/h2-7H,1H3;2-3H2,1H3,(H,5,6) |
| InChIKey | GZUSGFXXRRNRIM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole?
The IUPAC name of 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole (CID 67729957) is 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole.
What is the SMILES notation for 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole?
The canonical SMILES for 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole is CC1=NCCN1.Cn1ccc2ccccc21.
What is the InChIKey of 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole?
The InChIKey is GZUSGFXXRRNRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C4H8N2/c1-10-7-6-8-4-2-3-5-9(8)10;1-4-5-2-3-6-4/h2-7H,1H3;2-3H2,1H3,(H,5,6).
What are the key properties of 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole?
2-methyl-4,5-dihydro-1H-imidazole;1-methylindole has a molecular weight of 215.30 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-dihydro-1H-imidazole;1-methylindole is sourced from PubChem (CID 67729957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).