C25H38O8 — CID 67730999
[3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methoxy-2-(methoxymethyl)-2-methylpropanoate (PubChem CID 67730999) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is [3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methoxy-2-(methoxymethyl)-2-methylpropanoate.
| Compound Name | [3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methoxy-2-(methoxymethyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 67730999 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 3-methoxy-2-(methoxymethyl)-2-methylpropanoate |
| SMILES | COCC(C)(COC)C(=O)OC1CC(O)C=C2C=CC(C)C(CC[C@@H]3C[C@@H](O)CC(=O)O3)C21 |
| InChI | InChI=1S/C25H38O8/c1-15-5-6-16-9-17(26)11-21(33-24(29)25(2,13-30-3)14-31-4)23(16)20(15)8-7-19-10-18(27)12-22(28)32-19/h5-6,9,15,17-21,23,26-27H,7-8,10-14H2,1-4H3/t15?,17?,18-,19-,20?,21?,23?/m1/s1 |
| InChIKey | SUHVXBPBXMFOFW-NXOIZFJKSA-N |
| XLogP | 2.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |