C29H37FO7 — CID 67731019
[3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-[(4-fluorophenyl)methoxy]-2-methylpropanoate (PubChem CID 67731019) has the molecular formula C29H37FO7 and a molecular weight of 516.61 g/mol. Its IUPAC name is [3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-[(4-fluorophenyl)methoxy]-2-methylpropanoate.
| Compound Name | [3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-[(4-fluorophenyl)methoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 67731019 |
| Molecular Formula | C29H37FO7 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | [3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-[(4-fluorophenyl)methoxy]-2-methylpropanoate |
| SMILES | CC1C=CC2=CC(O)CC(OC(=O)C(C)(C)OCc3ccc(F)cc3)C2C1CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C29H37FO7/c1-17-4-7-19-12-21(31)14-25(27(19)24(17)11-10-23-13-22(32)15-26(33)36-23)37-28(34)29(2,3)35-16-18-5-8-20(30)9-6-18/h4-9,12,17,21-25,27,31-32H,10-11,13-16H2,1-3H3/t17?,21?,22-,23-,24?,25?,27?/m1/s1 |
| InChIKey | YVUBTPHJESDNRD-DROFEEPGSA-N |
| XLogP | 4.01 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |