C22H43N5O2 — CID 67732288
2,2,5,5-tetramethyl-N-[2-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethylamino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 67732288) has the molecular formula C22H43N5O2 and a molecular weight of 409.62 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[2-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethylamino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 2,2,5,5-tetramethyl-N-[2-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethylamino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 67732288 |
| Molecular Formula | C22H43N5O2 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.34 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[2-[2-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)amino]ethylamino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | CC1(C)CC(C(=O)NCCNCCNC(=O)C2CC(C)(C)NC2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C22H43N5O2/c1-19(2)13-15(21(5,6)26-19)17(28)24-11-9-23-10-12-25-18(29)16-14-20(3,4)27-22(16,7)8/h15-16,23,26-27H,9-14H2,1-8H3,(H,24,28)(H,25,29) |
| InChIKey | LLXWNWSZYTVVFQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|