About diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate
diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate (PubChem CID 67732818) has the molecular formula C28H34O6
and a molecular weight of 466.57 g/mol. Its IUPAC name is diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate.
Molecular Properties
| Compound Name | diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate |
| PubChem CID | 67732818 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate |
| SMILES | CCOC(=O)C(=CC1=CCC(=O)C=C1)CCCCCCC(=CC1=CCC(=O)C=C1)C(=O)OCC |
| InChI | InChI=1S/C28H34O6/c1-3-33-27(31)23(19-21-11-15-25(29)16-12-21)9-7-5-6-8-10-24(28(32)34-4-2)20-22-13-17-26(30)18-14-22/h11-15,17,19-20H,3-10,16,18H2,1-2H3 |
| InChIKey | ORELMOYBIMDMSL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate?
The IUPAC name of diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate (CID 67732818) is diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate.
What is the SMILES notation for diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate?
The canonical SMILES for diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate is CCOC(=O)C(=CC1=CCC(=O)C=C1)CCCCCCC(=CC1=CCC(=O)C=C1)C(=O)OCC.
What is the InChIKey of diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate?
The InChIKey is ORELMOYBIMDMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34O6/c1-3-33-27(31)23(19-21-11-15-25(29)16-12-21)9-7-5-6-8-10-24(28(32)34-4-2)20-22-13-17-26(30)18-14-22/h11-15,17,19-20H,3-10,16,18H2,1-2H3.
What are the key properties of diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate?
diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate has a molecular weight of 466.57 g/mol, XLogP of 5.22, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,9-bis[(4-oxocyclohexa-1,5-dien-1-yl)methylidene]decanedioate is sourced from PubChem (CID 67732818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).