C27H44N2 — CID 67732973
2,4,6-tritert-butylaniline;2,4,6-trimethylaniline (PubChem CID 67732973) has the molecular formula C27H44N2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 2,4,6-tritert-butylaniline;2,4,6-trimethylaniline.
| Compound Name | 2,4,6-tritert-butylaniline;2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 67732973 |
| Molecular Formula | C27H44N2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.35 |
| IUPAC Name | 2,4,6-tritert-butylaniline;2,4,6-trimethylaniline |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(N)c(C(C)(C)C)c1.Cc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C18H31N.C9H13N/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9;1-6-4-7(2)9(10)8(3)5-6/h10-11H,19H2,1-9H3;4-5H,10H2,1-3H3 |
| InChIKey | FUQICCYEHNSTFF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|