C11H20O5S — CID 67733196
1-[[(3aR,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]ethanol (PubChem CID 67733196) has the molecular formula C11H20O5S and a molecular weight of 264.34 g/mol. Its IUPAC name is 1-[[(3aR,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]ethanol.
| Compound Name | 1-[[(3aR,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 67733196 |
| Molecular Formula | C11H20O5S |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-[[(3aR,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]ethanol |
| SMILES | COC1O[C@H](CSC(C)O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C11H20O5S/c1-6(12)17-5-7-8-9(10(13-4)14-7)16-11(2,3)15-8/h6-10,12H,5H2,1-4H3/t6?,7-,8-,9-,10?/m1/s1 |
| InChIKey | BNYVIGHNOJRKPQ-KMWRWULUSA-N |
| XLogP | 0.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|