C12H16N2O2 — CID 67733558
(2S)-1-(1,2-benzoxazol-3-yloxy)-3-methylbutan-2-amine (PubChem CID 67733558) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-1-(1,2-benzoxazol-3-yloxy)-3-methylbutan-2-amine.
| Compound Name | (2S)-1-(1,2-benzoxazol-3-yloxy)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 67733558 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2S)-1-(1,2-benzoxazol-3-yloxy)-3-methylbutan-2-amine |
| SMILES | CC(C)[C@H](N)COc1noc2ccccc12 |
| InChI | InChI=1S/C12H16N2O2/c1-8(2)10(13)7-15-12-9-5-3-4-6-11(9)16-14-12/h3-6,8,10H,7,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | QFJPGPYLPPCIPX-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |