C42H57FN2O9 — CID 67733717
(4R)-4,7-dibenzyl-1-[3-[2-(4-fluorophenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one (PubChem CID 67733717) has the molecular formula C42H57FN2O9 and a molecular weight of 752.92 g/mol. Its IUPAC name is (4R)-4,7-dibenzyl-1-[3-[2-(4-fluorophenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one.
| Compound Name | (4R)-4,7-dibenzyl-1-[3-[2-(4-fluorophenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 67733717 |
| Molecular Formula | C42H57FN2O9 |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.40 |
| IUPAC Name | (4R)-4,7-dibenzyl-1-[3-[2-(4-fluorophenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one |
| SMILES | COCCOCOC1C(OCOCCOC)[C@@H](Cc2ccccc2)NC(=O)N(CCCC2(c3ccc(F)cc3)OCC(C)(C)CO2)C1Cc1ccccc1 |
| InChI | InChI=1S/C42H57FN2O9/c1-41(2)28-53-42(54-29-41,34-16-18-35(43)19-17-34)20-11-21-45-37(27-33-14-9-6-10-15-33)39(52-31-50-25-23-48-4)38(51-30-49-24-22-47-3)36(44-40(45)46)26-32-12-7-5-8-13-32/h5-10,12-19,36-39H,11,20-31H2,1-4H3,(H,44,46)/t36-,37?,38?,39?/m1/s1 |
| InChIKey | OREBKHLPPVTDAC-GLZIEPNMSA-N |
| XLogP | 6.09 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|