C18H19NO — CID 67733864
(4bR,9bS)-8-methoxy-4b,6-dimethyl-9b,10-dihydro-5H-indeno[1,2-b]indole (PubChem CID 67733864) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (4bR,9bS)-8-methoxy-4b,6-dimethyl-9b,10-dihydro-5H-indeno[1,2-b]indole.
| Compound Name | (4bR,9bS)-8-methoxy-4b,6-dimethyl-9b,10-dihydro-5H-indeno[1,2-b]indole |
|---|---|
| PubChem CID | 67733864 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (4bR,9bS)-8-methoxy-4b,6-dimethyl-9b,10-dihydro-5H-indeno[1,2-b]indole |
| SMILES | COc1cc(C)c2c(c1)[C@@H]1Cc3ccccc3[C@]1(C)N2 |
| InChI | InChI=1S/C18H19NO/c1-11-8-13(20-3)10-14-16-9-12-6-4-5-7-15(12)18(16,2)19-17(11)14/h4-8,10,16,19H,9H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | ICHLYSDXEGLLDH-WMZOPIPTSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|