C20H23NO — CID 67733888
(4bR,9bS)-8-methoxy-4b,6,10,10-tetramethyl-5,9b-dihydroindeno[1,2-b]indole (PubChem CID 67733888) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (4bR,9bS)-8-methoxy-4b,6,10,10-tetramethyl-5,9b-dihydroindeno[1,2-b]indole.
| Compound Name | (4bR,9bS)-8-methoxy-4b,6,10,10-tetramethyl-5,9b-dihydroindeno[1,2-b]indole |
|---|---|
| PubChem CID | 67733888 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (4bR,9bS)-8-methoxy-4b,6,10,10-tetramethyl-5,9b-dihydroindeno[1,2-b]indole |
| SMILES | COc1cc(C)c2c(c1)[C@@H]1C(C)(C)c3ccccc3[C@]1(C)N2 |
| InChI | InChI=1S/C20H23NO/c1-12-10-13(22-5)11-14-17(12)21-20(4)16-9-7-6-8-15(16)19(2,3)18(14)20/h6-11,18,21H,1-5H3/t18-,20+/m1/s1 |
| InChIKey | ZGKBGGJAQUBDFN-QUCCMNQESA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|