About 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine
4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine (PubChem CID 67734802) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 67734802 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine |
| SMILES | CC(C)n1ncnc1-c1ccncc1 |
| InChI | InChI=1S/C10H12N4/c1-8(2)14-10(12-7-13-14)9-3-5-11-6-4-9/h3-8H,1-2H3 |
| InChIKey | QKRXHRJSPRLBBW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine (CID 67734802) is 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine is CC(C)n1ncnc1-c1ccncc1.
What is the InChIKey of 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine?
The InChIKey is QKRXHRJSPRLBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-8(2)14-10(12-7-13-14)9-3-5-11-6-4-9/h3-8H,1-2H3.
What are the key properties of 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine?
4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine has a molecular weight of 188.23 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-propan-2-yl-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 67734802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).