C18H29N5O8 — CID 67734891
2-[(15Z)-4,10-bis(carboxymethyl)-2,12-dioxo-1,4,7,10,13-pentazacycloheptadec-15-en-7-yl]acetic acid (PubChem CID 67734891) has the molecular formula C18H29N5O8 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-[(15Z)-4,10-bis(carboxymethyl)-2,12-dioxo-1,4,7,10,13-pentazacycloheptadec-15-en-7-yl]acetic acid.
| Compound Name | 2-[(15Z)-4,10-bis(carboxymethyl)-2,12-dioxo-1,4,7,10,13-pentazacycloheptadec-15-en-7-yl]acetic acid |
|---|---|
| PubChem CID | 67734891 |
| Molecular Formula | C18H29N5O8 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-[(15Z)-4,10-bis(carboxymethyl)-2,12-dioxo-1,4,7,10,13-pentazacycloheptadec-15-en-7-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CC(=O)NC/C=C\CNC(=O)CN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H29N5O8/c24-14-9-22(12-17(28)29)7-5-21(11-16(26)27)6-8-23(13-18(30)31)10-15(25)20-4-2-1-3-19-14/h1-2H,3-13H2,(H,19,24)(H,20,25)(H,26,27)(H,28,29)(H,30,31)/b2-1- |
| InChIKey | UYWNUNCUZTVEJQ-UPHRSURJSA-N |
| XLogP | -3.05 |
| TPSA | 179.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|