About 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one
2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one (PubChem CID 67735176) has the molecular formula C19H13FO4S2
and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one |
| PubChem CID | 67735176 |
| Molecular Formula | C19H13FO4S2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one |
| SMILES | CS(=O)(=O)c1ccc(-c2c(-c3ccc(F)cc3)oc3c2SCC3=O)cc1 |
| InChI | InChI=1S/C19H13FO4S2/c1-26(22,23)14-8-4-11(5-9-14)16-17(12-2-6-13(20)7-3-12)24-18-15(21)10-25-19(16)18/h2-9H,10H2,1H3 |
| InChIKey | FZKREZMKOOUZQY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one?
The IUPAC name of 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one (CID 67735176) is 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one.
What is the SMILES notation for 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one?
The canonical SMILES for 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one is CS(=O)(=O)c1ccc(-c2c(-c3ccc(F)cc3)oc3c2SCC3=O)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one?
The InChIKey is FZKREZMKOOUZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13FO4S2/c1-26(22,23)14-8-4-11(5-9-14)16-17(12-2-6-13(20)7-3-12)24-18-15(21)10-25-19(16)18/h2-9H,10H2,1H3.
What are the key properties of 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one?
2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one has a molecular weight of 388.44 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)thieno[3,2-b]furan-6-one is sourced from PubChem (CID 67735176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).